C18H17ClNO5- — CID 7045109
(3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxyphenoxy)acetyl]amino]propanoate (PubChem CID 7045109) has the molecular formula C18H17ClNO5- and a molecular weight of 362.79 g/mol. Its IUPAC name is (3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxyphenoxy)acetyl]amino]propanoate.
| Compound Name | (3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxyphenoxy)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 7045109 |
| Molecular Formula | C18H17ClNO5- |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | (3R)-3-(4-chlorophenyl)-3-[[2-(2-methoxyphenoxy)acetyl]amino]propanoate |
| SMILES | COc1ccccc1OCC(=O)N[C@H](CC(=O)[O-])c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18ClNO5/c1-24-15-4-2-3-5-16(15)25-11-17(21)20-14(10-18(22)23)12-6-8-13(19)9-7-12/h2-9,14H,10-11H2,1H3,(H,20,21)(H,22,23)/p-1/t14-/m1/s1 |
| InChIKey | VYMFHCUGIWPYDP-CQSZACIVSA-M |
| XLogP | 1.72 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |