C25H29FN4O — CID 70451133
1'-[3-(cyclopropylmethyl)-8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-5-fluoro-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine] (PubChem CID 70451133) has the molecular formula C25H29FN4O and a molecular weight of 420.53 g/mol. Its IUPAC name is 1'-[3-(cyclopropylmethyl)-8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-5-fluoro-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine].
| Compound Name | 1'-[3-(cyclopropylmethyl)-8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-5-fluoro-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine] |
|---|---|
| PubChem CID | 70451133 |
| Molecular Formula | C25H29FN4O |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | 1'-[3-(cyclopropylmethyl)-8-methyl-[1,2,4]triazolo[4,3-a]pyridin-7-yl]-5-fluoro-3,3-dimethylspiro[2-benzofuran-1,4'-piperidine] |
| SMILES | Cc1c(N2CCC3(CC2)OC(C)(C)c2cc(F)ccc23)ccn2c(CC3CC3)nnc12 |
| InChI | InChI=1S/C25H29FN4O/c1-16-21(8-11-30-22(14-17-4-5-17)27-28-23(16)30)29-12-9-25(10-13-29)19-7-6-18(26)15-20(19)24(2,3)31-25/h6-8,11,15,17H,4-5,9-10,12-14H2,1-3H3 |
| InChIKey | JSLYCYPDHBMZHW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 42.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |