C14F4N8 — CID 70451314
4,6,15,17-tetrafluoro-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-10,11-dicarbonitrile (PubChem CID 70451314) has the molecular formula C14F4N8 and a molecular weight of 356.20 g/mol. Its IUPAC name is 4,6,15,17-tetrafluoro-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-10,11-dicarbonitrile.
| Compound Name | 4,6,15,17-tetrafluoro-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-10,11-dicarbonitrile |
|---|---|
| PubChem CID | 70451314 |
| Molecular Formula | C14F4N8 |
| Molecular Weight | 356.20 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 4,6,15,17-tetrafluoro-3,5,9,12,16,18-hexazatetracyclo[12.4.0.02,7.08,13]octadeca-1(14),2(7),3,5,8,10,12,15,17-nonaene-10,11-dicarbonitrile |
| SMILES | N#Cc1nc2c(nc1C#N)c1c(F)nc(F)nc1c1nc(F)nc(F)c12 |
| InChI | InChI=1S/C14F4N8/c15-11-5-7-8(22-4(2-20)3(1-19)21-7)6-10(9(5)23-13(17)25-11)24-14(18)26-12(6)16 |
| InChIKey | PCZVMCWREDBQFW-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 124.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.20 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|