C14H24ClNO — CID 70451533
2-chloro-N-ethyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide (PubChem CID 70451533) has the molecular formula C14H24ClNO and a molecular weight of 257.80 g/mol. Its IUPAC name is 2-chloro-N-ethyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide.
| Compound Name | 2-chloro-N-ethyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide |
|---|---|
| PubChem CID | 70451533 |
| Molecular Formula | C14H24ClNO |
| Molecular Weight | 257.80 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 2-chloro-N-ethyl-N-(3,3,5,5-tetramethylcyclohexen-1-yl)acetamide |
| SMILES | CCN(C(=O)CCl)C1=CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H24ClNO/c1-6-16(12(17)9-15)11-7-13(2,3)10-14(4,5)8-11/h7H,6,8-10H2,1-5H3 |
| InChIKey | JRIGPUMXNWZZOG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|