C14H21ClF3NO — CID 70451568
2-chloro-N-(3,3,5,5-tetramethylcyclohexen-1-yl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 70451568) has the molecular formula C14H21ClF3NO and a molecular weight of 311.78 g/mol. Its IUPAC name is 2-chloro-N-(3,3,5,5-tetramethylcyclohexen-1-yl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-chloro-N-(3,3,5,5-tetramethylcyclohexen-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 70451568 |
| Molecular Formula | C14H21ClF3NO |
| Molecular Weight | 311.78 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 2-chloro-N-(3,3,5,5-tetramethylcyclohexen-1-yl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CC1(C)C=C(N(CC(F)(F)F)C(=O)CCl)CC(C)(C)C1 |
| InChI | InChI=1S/C14H21ClF3NO/c1-12(2)5-10(6-13(3,4)8-12)19(11(20)7-15)9-14(16,17)18/h5H,6-9H2,1-4H3 |
| InChIKey | HFGOODSOAAPOQO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|