C15H25Cl2NO — CID 70451732
2-chloro-N-(2-chloroethyl)-N-(2,3,3,5,5-pentamethylcyclohexen-1-yl)acetamide (PubChem CID 70451732) has the molecular formula C15H25Cl2NO and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-chloro-N-(2-chloroethyl)-N-(2,3,3,5,5-pentamethylcyclohexen-1-yl)acetamide.
| Compound Name | 2-chloro-N-(2-chloroethyl)-N-(2,3,3,5,5-pentamethylcyclohexen-1-yl)acetamide |
|---|---|
| PubChem CID | 70451732 |
| Molecular Formula | C15H25Cl2NO |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-chloro-N-(2-chloroethyl)-N-(2,3,3,5,5-pentamethylcyclohexen-1-yl)acetamide |
| SMILES | CC1=C(N(CCCl)C(=O)CCl)CC(C)(C)CC1(C)C |
| InChI | InChI=1S/C15H25Cl2NO/c1-11-12(18(7-6-16)13(19)9-17)8-14(2,3)10-15(11,4)5/h6-10H2,1-5H3 |
| InChIKey | IOAXISQKDXINPZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|