C8H15NS — CID 70452161
7-propan-2-yl-2,3,4,5-tetrahydro-1,4-thiazepine (PubChem CID 70452161) has the molecular formula C8H15NS and a molecular weight of 157.28 g/mol. Its IUPAC name is 7-propan-2-yl-2,3,4,5-tetrahydro-1,4-thiazepine.
| Compound Name | 7-propan-2-yl-2,3,4,5-tetrahydro-1,4-thiazepine |
|---|---|
| PubChem CID | 70452161 |
| Molecular Formula | C8H15NS |
| Molecular Weight | 157.28 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 7-propan-2-yl-2,3,4,5-tetrahydro-1,4-thiazepine |
| SMILES | CC(C)C1=CCNCCS1 |
| InChI | InChI=1S/C8H15NS/c1-7(2)8-3-4-9-5-6-10-8/h3,7,9H,4-6H2,1-2H3 |
| InChIKey | XBRYDWZHKLRPKS-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.28 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |