C18H29NO — CID 70452670
[4-methyl-2,2,5,5-tetrakis(prop-2-enyl)pyrrolidin-3-yl]methanol (PubChem CID 70452670) has the molecular formula C18H29NO and a molecular weight of 275.44 g/mol. Its IUPAC name is [4-methyl-2,2,5,5-tetrakis(prop-2-enyl)pyrrolidin-3-yl]methanol.
| Compound Name | [4-methyl-2,2,5,5-tetrakis(prop-2-enyl)pyrrolidin-3-yl]methanol |
|---|---|
| PubChem CID | 70452670 |
| Molecular Formula | C18H29NO |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.22 |
| IUPAC Name | [4-methyl-2,2,5,5-tetrakis(prop-2-enyl)pyrrolidin-3-yl]methanol |
| SMILES | C=CCC1(CC=C)NC(CC=C)(CC=C)C(CO)C1C |
| InChI | InChI=1S/C18H29NO/c1-6-10-17(11-7-2)15(5)16(14-20)18(19-17,12-8-3)13-9-4/h6-9,15-16,19-20H,1-4,10-14H2,5H3 |
| InChIKey | BJSSWHVEXHHNDH-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|