C14H30O2 — CID 70452729
ethanol;1,2,2,5,5,6-hexamethylcyclohexan-1-ol (PubChem CID 70452729) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is ethanol;1,2,2,5,5,6-hexamethylcyclohexan-1-ol.
| Compound Name | ethanol;1,2,2,5,5,6-hexamethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 70452729 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | ethanol;1,2,2,5,5,6-hexamethylcyclohexan-1-ol |
| SMILES | CC1C(C)(C)CCC(C)(C)C1(C)O.CCO |
| InChI | InChI=1S/C12H24O.C2H6O/c1-9-10(2,3)7-8-11(4,5)12(9,6)13;1-2-3/h9,13H,7-8H2,1-6H3;3H,2H2,1H3 |
| InChIKey | ORHHGWPLGSMXGY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |