About 1-benzyl-3,5-dioxocyclohexane-1-carboxamide
1-benzyl-3,5-dioxocyclohexane-1-carboxamide (PubChem CID 70452873) has the molecular formula C14H15NO3
and a molecular weight of 245.28 g/mol. Its IUPAC name is 1-benzyl-3,5-dioxocyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | 1-benzyl-3,5-dioxocyclohexane-1-carboxamide |
| PubChem CID | 70452873 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 1-benzyl-3,5-dioxocyclohexane-1-carboxamide |
| SMILES | NC(=O)C1(Cc2ccccc2)CC(=O)CC(=O)C1 |
| InChI | InChI=1S/C14H15NO3/c15-13(18)14(7-10-4-2-1-3-5-10)8-11(16)6-12(17)9-14/h1-5H,6-9H2,(H2,15,18) |
| InChIKey | DFOXYFNTCDTKIQ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3,5-dioxocyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,5-dioxocyclohexane-1-carboxamide?
The IUPAC name of 1-benzyl-3,5-dioxocyclohexane-1-carboxamide (CID 70452873) is 1-benzyl-3,5-dioxocyclohexane-1-carboxamide.
What is the SMILES notation for 1-benzyl-3,5-dioxocyclohexane-1-carboxamide?
The canonical SMILES for 1-benzyl-3,5-dioxocyclohexane-1-carboxamide is NC(=O)C1(Cc2ccccc2)CC(=O)CC(=O)C1.
What is the InChIKey of 1-benzyl-3,5-dioxocyclohexane-1-carboxamide?
The InChIKey is DFOXYFNTCDTKIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO3/c15-13(18)14(7-10-4-2-1-3-5-10)8-11(16)6-12(17)9-14/h1-5H,6-9H2,(H2,15,18).
What are the key properties of 1-benzyl-3,5-dioxocyclohexane-1-carboxamide?
1-benzyl-3,5-dioxocyclohexane-1-carboxamide has a molecular weight of 245.28 g/mol, XLogP of 1.02, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,5-dioxocyclohexane-1-carboxamide is sourced from PubChem (CID 70452873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).