C6H5N3O2 — CID 70453266
1,3-dihydroimidazo[1,2-c]pyrimidine-2,7-dione (PubChem CID 70453266) has the molecular formula C6H5N3O2 and a molecular weight of 151.12 g/mol. Its IUPAC name is 1,3-dihydroimidazo[1,2-c]pyrimidine-2,7-dione.
| Compound Name | 1,3-dihydroimidazo[1,2-c]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 70453266 |
| Molecular Formula | C6H5N3O2 |
| Molecular Weight | 151.12 g/mol |
| Exact Mass | 151.04 |
| IUPAC Name | 1,3-dihydroimidazo[1,2-c]pyrimidine-2,7-dione |
| SMILES | O=C1Cn2cnc(=O)cc2N1 |
| InChI | InChI=1S/C6H5N3O2/c10-5-1-4-8-6(11)2-9(4)3-7-5/h1,3H,2H2,(H,8,11) |
| InChIKey | LBQVNVBCKAPUQY-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.12 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |