About 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane
1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane (PubChem CID 70453333) has the molecular formula C16H16Br4O
and a molecular weight of 543.92 g/mol. Its IUPAC name is 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane.
Molecular Properties
| Compound Name | 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane |
| PubChem CID | 70453333 |
| Molecular Formula | C16H16Br4O |
| Molecular Weight | 543.92 g/mol |
| Exact Mass | 539.79 |
| IUPAC Name | 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane |
| SMILES | Brc1cc(Br)cc(-c2cc(Br)cc(Br)c2)c1.CCOCC |
| InChI | InChI=1S/C12H6Br4.C4H10O/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8;1-3-5-4-2/h1-6H;3-4H2,1-2H3 |
| InChIKey | OZOJAJLLUZNMTK-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 543.92 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane?
The IUPAC name of 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane (CID 70453333) is 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane.
What is the SMILES notation for 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane?
The canonical SMILES for 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane is Brc1cc(Br)cc(-c2cc(Br)cc(Br)c2)c1.CCOCC.
What is the InChIKey of 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane?
The InChIKey is OZOJAJLLUZNMTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H6Br4.C4H10O/c13-9-1-7(2-10(14)5-9)8-3-11(15)6-12(16)4-8;1-3-5-4-2/h1-6H;3-4H2,1-2H3.
What are the key properties of 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane?
1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane has a molecular weight of 543.92 g/mol, XLogP of 7.45, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromo-5-(3,5-dibromophenyl)benzene;ethoxyethane is sourced from PubChem (CID 70453333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).