About 4-(butylideneamino)-3,5-dimethylphenol
4-(butylideneamino)-3,5-dimethylphenol (PubChem CID 70453399) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-(butylideneamino)-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-(butylideneamino)-3,5-dimethylphenol |
| PubChem CID | 70453399 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-(butylideneamino)-3,5-dimethylphenol |
| SMILES | CCC/C=N/c1c(C)cc(O)cc1C |
| InChI | InChI=1S/C12H17NO/c1-4-5-6-13-12-9(2)7-11(14)8-10(12)3/h6-8,14H,4-5H2,1-3H3/b13-6+ |
| InChIKey | FBKRHHIDNCKYNE-AWNIVKPZSA-N |
| XLogP | 3.51 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-(butylideneamino)-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(butylideneamino)-3,5-dimethylphenol?
The IUPAC name of 4-(butylideneamino)-3,5-dimethylphenol (CID 70453399) is 4-(butylideneamino)-3,5-dimethylphenol.
What is the SMILES notation for 4-(butylideneamino)-3,5-dimethylphenol?
The canonical SMILES for 4-(butylideneamino)-3,5-dimethylphenol is CCC/C=N/c1c(C)cc(O)cc1C.
What is the InChIKey of 4-(butylideneamino)-3,5-dimethylphenol?
The InChIKey is FBKRHHIDNCKYNE-AWNIVKPZSA-N. The full InChI is InChI=1S/C12H17NO/c1-4-5-6-13-12-9(2)7-11(14)8-10(12)3/h6-8,14H,4-5H2,1-3H3/b13-6+.
What are the key properties of 4-(butylideneamino)-3,5-dimethylphenol?
4-(butylideneamino)-3,5-dimethylphenol has a molecular weight of 191.27 g/mol, XLogP of 3.51, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(butylideneamino)-3,5-dimethylphenol is sourced from PubChem (CID 70453399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).