C15H18Cl2N4O3 — CID 70453538
1-[2-cyclopentyl-2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazole;nitric acid (PubChem CID 70453538) has the molecular formula C15H18Cl2N4O3 and a molecular weight of 373.24 g/mol. Its IUPAC name is 1-[2-cyclopentyl-2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazole;nitric acid.
| Compound Name | 1-[2-cyclopentyl-2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazole;nitric acid |
|---|---|
| PubChem CID | 70453538 |
| Molecular Formula | C15H18Cl2N4O3 |
| Molecular Weight | 373.24 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 1-[2-cyclopentyl-2-(2,4-dichlorophenyl)ethyl]-1,2,4-triazole;nitric acid |
| SMILES | Clc1ccc(C(Cn2cncn2)C2CCCC2)c(Cl)c1.O=[N+]([O-])O |
| InChI | InChI=1S/C15H17Cl2N3.HNO3/c16-12-5-6-13(15(17)7-12)14(11-3-1-2-4-11)8-20-10-18-9-19-20;2-1(3)4/h5-7,9-11,14H,1-4,8H2;(H,2,3,4) |
| InChIKey | NNSCNNYIJMQOTJ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.24 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|