C17H16N2O — CID 70453732
3-benzyl-4-(2-methylphenyl)-1H-imidazol-2-one (PubChem CID 70453732) has the molecular formula C17H16N2O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-benzyl-4-(2-methylphenyl)-1H-imidazol-2-one.
| Compound Name | 3-benzyl-4-(2-methylphenyl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 70453732 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 3-benzyl-4-(2-methylphenyl)-1H-imidazol-2-one |
| SMILES | Cc1ccccc1-c1c[nH]c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O/c1-13-7-5-6-10-15(13)16-11-18-17(20)19(16)12-14-8-3-2-4-9-14/h2-11H,12H2,1H3,(H,18,20) |
| InChIKey | AKTMBQCENLAPBU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |