C12H15NO2 — CID 70453882
(3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole-6,7-diol (PubChem CID 70453882) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is (3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole-6,7-diol.
| Compound Name | (3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole-6,7-diol |
|---|---|
| PubChem CID | 70453882 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | (3aR,9bS)-2,3,3a,4,5,9b-hexahydro-1H-benzo[e]isoindole-6,7-diol |
| SMILES | Oc1ccc2c(c1O)CC[C@H]1CNC[C@H]21 |
| InChI | InChI=1S/C12H15NO2/c14-11-4-3-8-9(12(11)15)2-1-7-5-13-6-10(7)8/h3-4,7,10,13-15H,1-2,5-6H2/t7-,10-/m0/s1 |
| InChIKey | SMQNEFRMAZRXLX-XVKPBYJWSA-N |
| XLogP | 1.35 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|