About 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid
3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid (PubChem CID 70454004) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid.
Molecular Properties
| Compound Name | 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid |
| PubChem CID | 70454004 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid |
| SMILES | C=Cc1c(C)cccc1C=CC#N.CC=C(C)C(=O)O |
| InChI | InChI=1S/C12H11N.C5H8O2/c1-3-12-10(2)6-4-7-11(12)8-5-9-13;1-3-4(2)5(6)7/h3-8H,1H2,2H3;3H,1-2H3,(H,6,7) |
| InChIKey | LJXQCMNHMZVMSA-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid?
The IUPAC name of 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid (CID 70454004) is 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid.
What is the SMILES notation for 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid?
The canonical SMILES for 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid is C=Cc1c(C)cccc1C=CC#N.CC=C(C)C(=O)O.
What is the InChIKey of 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid?
The InChIKey is LJXQCMNHMZVMSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C5H8O2/c1-3-12-10(2)6-4-7-11(12)8-5-9-13;1-3-4(2)5(6)7/h3-8H,1H2,2H3;3H,1-2H3,(H,6,7).
What are the key properties of 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid?
3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid has a molecular weight of 269.34 g/mol, XLogP of 4.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-ethenyl-3-methylphenyl)prop-2-enenitrile;2-methylbut-2-enoic acid is sourced from PubChem (CID 70454004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).