C12H19NO — CID 70454319
1-prop-2-enyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol (PubChem CID 70454319) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is 1-prop-2-enyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol.
| Compound Name | 1-prop-2-enyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol |
|---|---|
| PubChem CID | 70454319 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 1-prop-2-enyl-3,4,4a,5,6,7-hexahydro-2H-quinolin-6-ol |
| SMILES | C=CCN1CCCC2CC(O)CC=C21 |
| InChI | InChI=1S/C12H19NO/c1-2-7-13-8-3-4-10-9-11(14)5-6-12(10)13/h2,6,10-11,14H,1,3-5,7-9H2 |
| InChIKey | ZRWMAMIOXLSGRJ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|