About (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate
(3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate (PubChem CID 70454576) has the molecular formula C7H13N3O3
and a molecular weight of 187.20 g/mol. Its IUPAC name is (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate.
Molecular Properties
| Compound Name | (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate |
| PubChem CID | 70454576 |
| Molecular Formula | C7H13N3O3 |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate |
| SMILES | CCNC(=O)OC1CNC(=O)N1C |
| InChI | InChI=1S/C7H13N3O3/c1-3-8-7(12)13-5-4-9-6(11)10(5)2/h5H,3-4H2,1-2H3,(H,8,12)(H,9,11) |
| InChIKey | PJKUGNSSQSBEAI-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate?
The IUPAC name of (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate (CID 70454576) is (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate.
What is the SMILES notation for (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate?
The canonical SMILES for (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate is CCNC(=O)OC1CNC(=O)N1C.
What is the InChIKey of (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate?
The InChIKey is PJKUGNSSQSBEAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N3O3/c1-3-8-7(12)13-5-4-9-6(11)10(5)2/h5H,3-4H2,1-2H3,(H,8,12)(H,9,11).
What are the key properties of (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate?
(3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate has a molecular weight of 187.20 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-2-oxoimidazolidin-4-yl) N-ethylcarbamate is sourced from PubChem (CID 70454576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).