About copper;ethyl hypobromite;2,4,6-trimethylpyridine
copper;ethyl hypobromite;2,4,6-trimethylpyridine (PubChem CID 70454604) has the molecular formula C10H16BrCuNO
and a molecular weight of 309.69 g/mol. Its IUPAC name is copper;ethyl hypobromite;2,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | copper;ethyl hypobromite;2,4,6-trimethylpyridine |
| PubChem CID | 70454604 |
| Molecular Formula | C10H16BrCuNO |
| Molecular Weight | 309.69 g/mol |
| Exact Mass | 307.97 |
| IUPAC Name | copper;ethyl hypobromite;2,4,6-trimethylpyridine |
| SMILES | CCOBr.Cc1cc(C)nc(C)c1.[Cu] |
| InChI | InChI=1S/C8H11N.C2H5BrO.Cu/c1-6-4-7(2)9-8(3)5-6;1-2-4-3;/h4-5H,1-3H3;2H2,1H3; |
| InChIKey | QZZRCSUVRXBMMW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.69 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;ethyl hypobromite;2,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;ethyl hypobromite;2,4,6-trimethylpyridine?
The IUPAC name of copper;ethyl hypobromite;2,4,6-trimethylpyridine (CID 70454604) is copper;ethyl hypobromite;2,4,6-trimethylpyridine.
What is the SMILES notation for copper;ethyl hypobromite;2,4,6-trimethylpyridine?
The canonical SMILES for copper;ethyl hypobromite;2,4,6-trimethylpyridine is CCOBr.Cc1cc(C)nc(C)c1.[Cu].
What is the InChIKey of copper;ethyl hypobromite;2,4,6-trimethylpyridine?
The InChIKey is QZZRCSUVRXBMMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C2H5BrO.Cu/c1-6-4-7(2)9-8(3)5-6;1-2-4-3;/h4-5H,1-3H3;2H2,1H3;.
What are the key properties of copper;ethyl hypobromite;2,4,6-trimethylpyridine?
copper;ethyl hypobromite;2,4,6-trimethylpyridine has a molecular weight of 309.69 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;ethyl hypobromite;2,4,6-trimethylpyridine is sourced from PubChem (CID 70454604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).