C14H20N2 — CID 70454609
(5aS,8aS)-5-prop-2-enyl-4a,5,5a,6,7,8,8a,9-octahydro-4H-pyrrolo[3,4-g]quinoline (PubChem CID 70454609) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is (5aS,8aS)-5-prop-2-enyl-4a,5,5a,6,7,8,8a,9-octahydro-4H-pyrrolo[3,4-g]quinoline.
| Compound Name | (5aS,8aS)-5-prop-2-enyl-4a,5,5a,6,7,8,8a,9-octahydro-4H-pyrrolo[3,4-g]quinoline |
|---|---|
| PubChem CID | 70454609 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | (5aS,8aS)-5-prop-2-enyl-4a,5,5a,6,7,8,8a,9-octahydro-4H-pyrrolo[3,4-g]quinoline |
| SMILES | C=CCC1C2CC=CN=C2C[C@@H]2CNC[C@@H]12 |
| InChI | InChI=1S/C14H20N2/c1-2-4-11-12-5-3-6-16-14(12)7-10-8-15-9-13(10)11/h2-3,6,10-13,15H,1,4-5,7-9H2/t10-,11?,12?,13-/m1/s1 |
| InChIKey | LVTHUISNNWHMTR-IKWCTNDRSA-N |
| XLogP | 2.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|