C11H15N3O4 — CID 70454612
1-aminocyclohexa-2,4-diene-1-carboxylic acid;3-methylimidazolidine-2,4-dione (PubChem CID 70454612) has the molecular formula C11H15N3O4 and a molecular weight of 253.26 g/mol. Its IUPAC name is 1-aminocyclohexa-2,4-diene-1-carboxylic acid;3-methylimidazolidine-2,4-dione.
| Compound Name | 1-aminocyclohexa-2,4-diene-1-carboxylic acid;3-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 70454612 |
| Molecular Formula | C11H15N3O4 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | 1-aminocyclohexa-2,4-diene-1-carboxylic acid;3-methylimidazolidine-2,4-dione |
| SMILES | CN1C(=O)CNC1=O.NC1(C(=O)O)C=CC=CC1 |
| InChI | InChI=1S/C7H9NO2.C4H6N2O2/c8-7(6(9)10)4-2-1-3-5-7;1-6-3(7)2-5-4(6)8/h1-4H,5,8H2,(H,9,10);2H2,1H3,(H,5,8) |
| InChIKey | QDEMXIBDGMKQNO-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|