About 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid
2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid (PubChem CID 7045484) has the molecular formula C19H18N2O4S
and a molecular weight of 370.43 g/mol. Its IUPAC name is 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid.
Molecular Properties
| Compound Name | 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid |
| PubChem CID | 7045484 |
| Molecular Formula | C19H18N2O4S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.10 |
| IUPAC Name | 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid |
| SMILES | Cc1ccc(N2C(=O)S[C@H](N(CC(=O)O)c3cccc(C)c3)C2=O)cc1 |
| InChI | InChI=1S/C19H18N2O4S/c1-12-6-8-14(9-7-12)21-17(24)18(26-19(21)25)20(11-16(22)23)15-5-3-4-13(2)10-15/h3-10,18H,11H2,1-2H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | CDJBCYOJDSIHIR-SFHVURJKSA-N |
| XLogP | 3.42 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid?
The IUPAC name of 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid (CID 7045484) is 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid.
What is the SMILES notation for 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid?
The canonical SMILES for 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid is Cc1ccc(N2C(=O)S[C@H](N(CC(=O)O)c3cccc(C)c3)C2=O)cc1.
What is the InChIKey of 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid?
The InChIKey is CDJBCYOJDSIHIR-SFHVURJKSA-N. The full InChI is InChI=1S/C19H18N2O4S/c1-12-6-8-14(9-7-12)21-17(24)18(26-19(21)25)20(11-16(22)23)15-5-3-4-13(2)10-15/h3-10,18H,11H2,1-2H3,(H,22,23)/t18-/m0/s1.
What are the key properties of 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid?
2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid has a molecular weight of 370.43 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-methyl-N-[(5S)-3-(4-methylphenyl)-2,4-dioxo-1,3-thiazolidin-5-yl]anilino)acetic acid is sourced from PubChem (CID 7045484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).