C23H26N2O2S — CID 70454995
N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-3-phenylfuran-2-carboxamide (PubChem CID 70454995) has the molecular formula C23H26N2O2S and a molecular weight of 394.54 g/mol. Its IUPAC name is N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-3-phenylfuran-2-carboxamide.
| Compound Name | N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-3-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 70454995 |
| Molecular Formula | C23H26N2O2S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[3-methyl-1-(2-thiophen-2-ylethyl)piperidin-4-yl]-3-phenylfuran-2-carboxamide |
| SMILES | CC1CN(CCc2cccs2)CCC1NC(=O)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C23H26N2O2S/c1-17-16-25(12-9-19-8-5-15-28-19)13-10-21(17)24-23(26)22-20(11-14-27-22)18-6-3-2-4-7-18/h2-8,11,14-15,17,21H,9-10,12-13,16H2,1H3,(H,24,26) |
| InChIKey | JAQYHOSHTULRSZ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |