C33H61FO5Si2 — CID 70455319
methyl (5S)-5-[(3aS,4R,5R,6aS)-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-yl]-5-fluoropentanoate (PubChem CID 70455319) has the molecular formula C33H61FO5Si2 and a molecular weight of 613.02 g/mol. Its IUPAC name is methyl (5S)-5-[(3aS,4R,5R,6aS)-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-yl]-5-fluoropentanoate.
| Compound Name | methyl (5S)-5-[(3aS,4R,5R,6aS)-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-yl]-5-fluoropentanoate |
|---|---|
| PubChem CID | 70455319 |
| Molecular Formula | C33H61FO5Si2 |
| Molecular Weight | 613.02 g/mol |
| Exact Mass | 612.40 |
| IUPAC Name | methyl (5S)-5-[(3aS,4R,5R,6aS)-5-triethylsilyloxy-4-[(E,3S)-3-triethylsilyloxyoct-1-enyl]-4,5,6,6a-tetrahydro-3aH-cyclopenta[b]furan-2-yl]-5-fluoropentanoate |
| SMILES | CCCCC[C@@H](/C=C/[C@@H]1[C@H]2C=C([C@@H](F)CCCC(=O)OC)O[C@H]2C[C@H]1O[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H61FO5Si2/c1-9-16-17-19-26(38-40(10-2,11-3)12-4)22-23-27-28-24-32(29(34)20-18-21-33(35)36-8)37-30(28)25-31(27)39-41(13-5,14-6)15-7/h22-24,26-31H,9-21,25H2,1-8H3/b23-22+/t26-,27+,28+,29-,30-,31+/m0/s1 |
| InChIKey | WARGPIBDGACNMF-QMOSGEONSA-N |
| XLogP | 9.50 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.02 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|