About 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol
2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 70455380) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol |
| PubChem CID | 70455380 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | CCC1(CCO)C=CC(N)=CC1N |
| InChI | InChI=1S/C10H18N2O/c1-2-10(5-6-13)4-3-8(11)7-9(10)12/h3-4,7,9,13H,2,5-6,11-12H2,1H3 |
| InChIKey | MHIZVJGOKFRADR-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol?
The IUPAC name of 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol (CID 70455380) is 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol.
What is the SMILES notation for 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol?
The canonical SMILES for 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol is CCC1(CCO)C=CC(N)=CC1N.
What is the InChIKey of 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol?
The InChIKey is MHIZVJGOKFRADR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c1-2-10(5-6-13)4-3-8(11)7-9(10)12/h3-4,7,9,13H,2,5-6,11-12H2,1H3.
What are the key properties of 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol?
2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol has a molecular weight of 182.27 g/mol, XLogP of 0.50, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diamino-1-ethylcyclohexa-2,4-dien-1-yl)ethanol is sourced from PubChem (CID 70455380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).