C18H25ClN6O5S — CID 70455695
(2S,5R,6R)-3,3-dimethyl-6-[[4-[(2-nitroimidazol-1-yl)methyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride (PubChem CID 70455695) has the molecular formula C18H25ClN6O5S and a molecular weight of 472.96 g/mol. Its IUPAC name is (2S,5R,6R)-3,3-dimethyl-6-[[4-[(2-nitroimidazol-1-yl)methyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride.
| Compound Name | (2S,5R,6R)-3,3-dimethyl-6-[[4-[(2-nitroimidazol-1-yl)methyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride |
|---|---|
| PubChem CID | 70455695 |
| Molecular Formula | C18H25ClN6O5S |
| Molecular Weight | 472.96 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (2S,5R,6R)-3,3-dimethyl-6-[[4-[(2-nitroimidazol-1-yl)methyl]piperidin-1-yl]methylideneamino]-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid;hydrochloride |
| SMILES | CC1(C)S[C@@H]2[C@H](/N=C/N3CCC(Cn4ccnc4[N+](=O)[O-])CC3)C(=O)N2[C@H]1C(=O)O.Cl |
| InChI | InChI=1S/C18H24N6O5S.ClH/c1-18(2)13(16(26)27)23-14(25)12(15(23)30-18)20-10-21-6-3-11(4-7-21)9-22-8-5-19-17(22)24(28)29;/h5,8,10-13,15H,3-4,6-7,9H2,1-2H3,(H,26,27);1H/b20-10+;/t12-,13+,15-;/m1./s1 |
| InChIKey | MYJFMLUUACCWTI-UACJKUSVSA-N |
| XLogP | 1.47 |
| TPSA | 134.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.96 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|