About 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid
5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid (PubChem CID 70455792) has the molecular formula C10H14N4O3
and a molecular weight of 238.25 g/mol. Its IUPAC name is 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid |
| PubChem CID | 70455792 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid |
| SMILES | CCOc1ccn[nH]1.O=C(O)N1C=NC=CC1 |
| InChI | InChI=1S/C5H6N2O2.C5H8N2O/c8-5(9)7-3-1-2-6-4-7;1-2-8-5-3-4-6-7-5/h1-2,4H,3H2,(H,8,9);3-4H,2H2,1H3,(H,6,7) |
| InChIKey | VHQIYRQEFQUJDY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid?
The IUPAC name of 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid (CID 70455792) is 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid.
What is the SMILES notation for 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid?
The canonical SMILES for 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid is CCOc1ccn[nH]1.O=C(O)N1C=NC=CC1.
What is the InChIKey of 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid?
The InChIKey is VHQIYRQEFQUJDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O2.C5H8N2O/c8-5(9)7-3-1-2-6-4-7;1-2-8-5-3-4-6-7-5/h1-2,4H,3H2,(H,8,9);3-4H,2H2,1H3,(H,6,7).
What are the key properties of 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid?
5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid has a molecular weight of 238.25 g/mol, XLogP of 1.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethoxy-1H-pyrazole;4H-pyrimidine-3-carboxylic acid is sourced from PubChem (CID 70455792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).