About prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate
prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate (PubChem CID 70455854) has the molecular formula C11H12ClNO2
and a molecular weight of 225.67 g/mol. Its IUPAC name is prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate |
| PubChem CID | 70455854 |
| Molecular Formula | C11H12ClNO2 |
| Molecular Weight | 225.67 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate |
| SMILES | C=CCOC(=O)C1=CCC(=NCCl)C=C1 |
| InChI | InChI=1S/C11H12ClNO2/c1-2-7-15-11(14)9-3-5-10(6-4-9)13-8-12/h2-5H,1,6-8H2 |
| InChIKey | KVBXAZFSCICBGQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.67 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate?
The IUPAC name of prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate (CID 70455854) is prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate.
What is the SMILES notation for prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate?
The canonical SMILES for prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate is C=CCOC(=O)C1=CCC(=NCCl)C=C1.
What is the InChIKey of prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate?
The InChIKey is KVBXAZFSCICBGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO2/c1-2-7-15-11(14)9-3-5-10(6-4-9)13-8-12/h2-5H,1,6-8H2.
What are the key properties of prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate?
prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate has a molecular weight of 225.67 g/mol, XLogP of 2.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate is sourced from PubChem (CID 70455854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).