C21H31N3O5S — CID 70456314
(2R)-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(diethylamino)hexanoic acid (PubChem CID 70456314) has the molecular formula C21H31N3O5S and a molecular weight of 437.56 g/mol. Its IUPAC name is (2R)-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(diethylamino)hexanoic acid.
| Compound Name | (2R)-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(diethylamino)hexanoic acid |
|---|---|
| PubChem CID | 70456314 |
| Molecular Formula | C21H31N3O5S |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | (2R)-2-[[5-(carboxymethyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]amino]-6-(diethylamino)hexanoic acid |
| SMILES | CCN(CC)CCCC[C@@H](NC1CSc2ccccc2N(CC(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C21H31N3O5S/c1-3-23(4-2)12-8-7-9-15(21(28)29)22-16-14-30-18-11-6-5-10-17(18)24(20(16)27)13-19(25)26/h5-6,10-11,15-16,22H,3-4,7-9,12-14H2,1-2H3,(H,25,26)(H,28,29)/t15-,16?/m1/s1 |
| InChIKey | SHWVOJROCBYRLO-AAFJCEBUSA-N |
| XLogP | 2.13 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|