About methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride
methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride (PubChem CID 70456484) has the molecular formula C9H11Cl2NO2
and a molecular weight of 236.10 g/mol. Its IUPAC name is methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride.
Molecular Properties
| Compound Name | methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride |
| PubChem CID | 70456484 |
| Molecular Formula | C9H11Cl2NO2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.02 |
| IUPAC Name | methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride |
| SMILES | COC(=O)C1=CCC(=NCCl)C=C1.Cl |
| InChI | InChI=1S/C9H10ClNO2.ClH/c1-13-9(12)7-2-4-8(5-3-7)11-6-10;/h2-4H,5-6H2,1H3;1H |
| InChIKey | PQUDFIXGKHFHIW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride?
The IUPAC name of methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride (CID 70456484) is methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride.
What is the SMILES notation for methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride?
The canonical SMILES for methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride is COC(=O)C1=CCC(=NCCl)C=C1.Cl.
What is the InChIKey of methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride?
The InChIKey is PQUDFIXGKHFHIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClNO2.ClH/c1-13-9(12)7-2-4-8(5-3-7)11-6-10;/h2-4H,5-6H2,1H3;1H.
What are the key properties of methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride?
methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride has a molecular weight of 236.10 g/mol, XLogP of 2.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(chloromethylimino)cyclohexa-1,5-diene-1-carboxylate;hydrochloride is sourced from PubChem (CID 70456484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).