About 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid
4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid (PubChem CID 704565) has the molecular formula C15H11N3O2S
and a molecular weight of 297.34 g/mol. Its IUPAC name is 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid.
Molecular Properties
| Compound Name | 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| PubChem CID | 704565 |
| Molecular Formula | C15H11N3O2S |
| Molecular Weight | 297.34 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2nc(-c3cccnc3)cs2)cc1 |
| InChI | InChI=1S/C15H11N3O2S/c19-14(20)10-3-5-12(6-4-10)17-15-18-13(9-21-15)11-2-1-7-16-8-11/h1-9H,(H,17,18)(H,19,20) |
| InChIKey | VOAGRCWYJDZBFU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
The IUPAC name of 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid (CID 704565) is 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid.
What is the SMILES notation for 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
The canonical SMILES for 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid is O=C(O)c1ccc(Nc2nc(-c3cccnc3)cs2)cc1.
What is the InChIKey of 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
The InChIKey is VOAGRCWYJDZBFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11N3O2S/c19-14(20)10-3-5-12(6-4-10)17-15-18-13(9-21-15)11-2-1-7-16-8-11/h1-9H,(H,17,18)(H,19,20).
What are the key properties of 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid?
4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid has a molecular weight of 297.34 g/mol, XLogP of 3.65, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-pyridin-3-yl-1,3-thiazol-2-yl)amino]benzoic acid is sourced from PubChem (CID 704565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).