About [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium
[(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium (PubChem CID 7045654) has the molecular formula C3H7N2O2+
and a molecular weight of 103.10 g/mol. Its IUPAC name is [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium.
Molecular Properties
| Compound Name | [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium |
| PubChem CID | 7045654 |
| Molecular Formula | C3H7N2O2+ |
| Molecular Weight | 103.10 g/mol |
| Exact Mass | 103.05 |
| IUPAC Name | [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium |
| SMILES | [NH3+][C@@H]1CONC1=O |
| InChI | InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/p+1/t2-/m1/s1 |
| InChIKey | DYDCUQKUCUHJBH-UWTATZPHSA-O |
| XLogP | -2.34 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 103.10 |
| LogP ≤ 5 | -2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium?
The IUPAC name of [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium (CID 7045654) is [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium.
What is the SMILES notation for [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium?
The canonical SMILES for [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium is [NH3+][C@@H]1CONC1=O.
What is the InChIKey of [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium?
The InChIKey is DYDCUQKUCUHJBH-UWTATZPHSA-O. The full InChI is InChI=1S/C3H6N2O2/c4-2-1-7-5-3(2)6/h2H,1,4H2,(H,5,6)/p+1/t2-/m1/s1.
What are the key properties of [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium?
[(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium has a molecular weight of 103.10 g/mol, XLogP of -2.34, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R)-3-oxo-1,2-oxazolidin-4-yl]azanium is sourced from PubChem (CID 7045654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).