C17H18Cl4FN5 — CID 70456647
3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-N'-[(4-fluorophenyl)methyl]benzenecarboximidamide;dihydrochloride (PubChem CID 70456647) has the molecular formula C17H18Cl4FN5 and a molecular weight of 453.18 g/mol. Its IUPAC name is 3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-N'-[(4-fluorophenyl)methyl]benzenecarboximidamide;dihydrochloride.
| Compound Name | 3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-N'-[(4-fluorophenyl)methyl]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 70456647 |
| Molecular Formula | C17H18Cl4FN5 |
| Molecular Weight | 453.18 g/mol |
| Exact Mass | 451.03 |
| IUPAC Name | 3,5-dichloro-4-(4,5-dihydro-1H-imidazol-2-ylamino)-N'-[(4-fluorophenyl)methyl]benzenecarboximidamide;dihydrochloride |
| SMILES | Cl.Cl.N/C(=N\Cc1ccc(F)cc1)c1cc(Cl)c(NC2=NCCN2)c(Cl)c1 |
| InChI | InChI=1S/C17H16Cl2FN5.2ClH/c18-13-7-11(8-14(19)15(13)25-17-22-5-6-23-17)16(21)24-9-10-1-3-12(20)4-2-10;;/h1-4,7-8H,5-6,9H2,(H2,21,24)(H2,22,23,25);2*1H |
| InChIKey | OBMHSAPBZRZJPB-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 74.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.18 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|