C20H18N4O5S2 — CID 70456728
methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate (PubChem CID 70456728) has the molecular formula C20H18N4O5S2 and a molecular weight of 458.52 g/mol. Its IUPAC name is methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate.
| Compound Name | methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate |
|---|---|
| PubChem CID | 70456728 |
| Molecular Formula | C20H18N4O5S2 |
| Molecular Weight | 458.52 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | methyl (E)-2-[3-(1,3-dioxoisoindol-2-yl)-2-oxoazetidin-1-yl]-3-methyl-4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate |
| SMILES | COC(=O)/C(=C(/C)CSc1nnc(C)s1)N1CC(N2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C20H18N4O5S2/c1-10(9-30-20-22-21-11(2)31-20)15(19(28)29-3)23-8-14(18(23)27)24-16(25)12-6-4-5-7-13(12)17(24)26/h4-7,14H,8-9H2,1-3H3/b15-10+ |
| InChIKey | FOURHYWIIFKMHW-XNTDXEJSSA-N |
| XLogP | 1.89 |
| TPSA | 109.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|