About 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea
1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea (PubChem CID 70456849) has the molecular formula C6H9N5O2
and a molecular weight of 183.17 g/mol. Its IUPAC name is 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea |
| PubChem CID | 70456849 |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.17 g/mol |
| Exact Mass | 183.08 |
| IUPAC Name | 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea |
| SMILES | C/N=C(\N)NC(=O)Nc1ncco1 |
| InChI | InChI=1S/C6H9N5O2/c1-8-4(7)10-5(12)11-6-9-2-3-13-6/h2-3H,1H3,(H4,7,8,9,10,11,12) |
| InChIKey | XJZOEUAMQGBRMM-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.17 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea?
The IUPAC name of 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea (CID 70456849) is 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea.
What is the SMILES notation for 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea?
The canonical SMILES for 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea is C/N=C(\N)NC(=O)Nc1ncco1.
What is the InChIKey of 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea?
The InChIKey is XJZOEUAMQGBRMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N5O2/c1-8-4(7)10-5(12)11-6-9-2-3-13-6/h2-3H,1H3,(H4,7,8,9,10,11,12).
What are the key properties of 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea?
1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea has a molecular weight of 183.17 g/mol, XLogP of -0.26, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N'-methylcarbamimidoyl)-3-(1,3-oxazol-2-yl)urea is sourced from PubChem (CID 70456849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).