C16H11Cl2N3O — CID 70456902
2-(2,4-dichlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanone (PubChem CID 70456902) has the molecular formula C16H11Cl2N3O and a molecular weight of 332.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanone.
| Compound Name | 2-(2,4-dichlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanone |
|---|---|
| PubChem CID | 70456902 |
| Molecular Formula | C16H11Cl2N3O |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-1-phenyl-2-(1H-1,2,4-triazol-5-yl)ethanone |
| SMILES | O=C(c1ccccc1)C(c1ncn[nH]1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H11Cl2N3O/c17-11-6-7-12(13(18)8-11)14(16-19-9-20-21-16)15(22)10-4-2-1-3-5-10/h1-9,14H,(H,19,20,21) |
| InChIKey | TZDGKHRFSSGVNQ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |