C12H13BrClFO3 — CID 70457068
2-bromo-2-chloro-5-[(3-fluorophenyl)methoxy]pentanoic acid (PubChem CID 70457068) has the molecular formula C12H13BrClFO3 and a molecular weight of 339.59 g/mol. Its IUPAC name is 2-bromo-2-chloro-5-[(3-fluorophenyl)methoxy]pentanoic acid.
| Compound Name | 2-bromo-2-chloro-5-[(3-fluorophenyl)methoxy]pentanoic acid |
|---|---|
| PubChem CID | 70457068 |
| Molecular Formula | C12H13BrClFO3 |
| Molecular Weight | 339.59 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 2-bromo-2-chloro-5-[(3-fluorophenyl)methoxy]pentanoic acid |
| SMILES | O=C(O)C(Cl)(Br)CCCOCc1cccc(F)c1 |
| InChI | InChI=1S/C12H13BrClFO3/c13-12(14,11(16)17)5-2-6-18-8-9-3-1-4-10(15)7-9/h1,3-4,7H,2,5-6,8H2,(H,16,17) |
| InChIKey | FNGQCDHMAFEGEJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|