C18H28N2O — CID 70457360
4-methoxy-N,N'-dipropyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide (PubChem CID 70457360) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is 4-methoxy-N,N'-dipropyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide.
| Compound Name | 4-methoxy-N,N'-dipropyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide |
|---|---|
| PubChem CID | 70457360 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 4-methoxy-N,N'-dipropyl-5,6,7,8-tetrahydronaphthalene-1-carboximidamide |
| SMILES | CCC/N=C(\NCCC)c1ccc(OC)c2c1CCCC2 |
| InChI | InChI=1S/C18H28N2O/c1-4-12-19-18(20-13-5-2)16-10-11-17(21-3)15-9-7-6-8-14(15)16/h10-11H,4-9,12-13H2,1-3H3,(H,19,20) |
| InChIKey | FYVOALMTYVNXSU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|