About 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione
5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione (PubChem CID 70457706) has the molecular formula C6H11N3S2
and a molecular weight of 189.31 g/mol. Its IUPAC name is 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione.
Molecular Properties
| Compound Name | 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione |
| PubChem CID | 70457706 |
| Molecular Formula | C6H11N3S2 |
| Molecular Weight | 189.31 g/mol |
| Exact Mass | 189.04 |
| IUPAC Name | 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione |
| SMILES | NCCNCc1c[nH]c(=S)s1 |
| InChI | InChI=1S/C6H11N3S2/c7-1-2-8-3-5-4-9-6(10)11-5/h4,8H,1-3,7H2,(H,9,10) |
| InChIKey | WVSOHRRUZRVZPC-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 53.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione?
The IUPAC name of 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione (CID 70457706) is 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione.
What is the SMILES notation for 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione?
The canonical SMILES for 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione is NCCNCc1c[nH]c(=S)s1.
What is the InChIKey of 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione?
The InChIKey is WVSOHRRUZRVZPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3S2/c7-1-2-8-3-5-4-9-6(10)11-5/h4,8H,1-3,7H2,(H,9,10).
What are the key properties of 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione?
5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione has a molecular weight of 189.31 g/mol, XLogP of 0.85, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2-aminoethylamino)methyl]-3H-1,3-thiazole-2-thione is sourced from PubChem (CID 70457706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).