C8H17N3O — CID 70457851
N'-[(2,5-dimethyl-5H-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine (PubChem CID 70457851) has the molecular formula C8H17N3O and a molecular weight of 171.24 g/mol. Its IUPAC name is N'-[(2,5-dimethyl-5H-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-[(2,5-dimethyl-5H-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 70457851 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | N'-[(2,5-dimethyl-5H-1,2-oxazol-4-yl)methyl]ethane-1,2-diamine |
| SMILES | CC1ON(C)C=C1CNCCN |
| InChI | InChI=1S/C8H17N3O/c1-7-8(5-10-4-3-9)6-11(2)12-7/h6-7,10H,3-5,9H2,1-2H3 |
| InChIKey | BJLIGPQEAHFXIM-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|