About N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine
N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine (PubChem CID 70457956) has the molecular formula C6H10FN3O
and a molecular weight of 159.16 g/mol. Its IUPAC name is N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine |
| PubChem CID | 70457956 |
| Molecular Formula | C6H10FN3O |
| Molecular Weight | 159.16 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cc(F)no1 |
| InChI | InChI=1S/C6H10FN3O/c7-6-3-5(11-10-6)4-9-2-1-8/h3,9H,1-2,4,8H2 |
| InChIKey | AEHBOZRIGCNMAL-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.16 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine (CID 70457956) is N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine is NCCNCc1cc(F)no1.
What is the InChIKey of N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine?
The InChIKey is AEHBOZRIGCNMAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10FN3O/c7-6-3-5(11-10-6)4-9-2-1-8/h3,9H,1-2,4,8H2.
What are the key properties of N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine?
N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine has a molecular weight of 159.16 g/mol, XLogP of -0.14, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(3-fluoro-1,2-oxazol-5-yl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 70457956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).