C12H17NO2 — CID 70458047
7-methoxy-4-prop-2-enyl-2,3,4a,5-tetrahydro-1,4-benzoxazine (PubChem CID 70458047) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 7-methoxy-4-prop-2-enyl-2,3,4a,5-tetrahydro-1,4-benzoxazine.
| Compound Name | 7-methoxy-4-prop-2-enyl-2,3,4a,5-tetrahydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 70458047 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 7-methoxy-4-prop-2-enyl-2,3,4a,5-tetrahydro-1,4-benzoxazine |
| SMILES | C=CCN1CCOC2=CC(OC)=CCC21 |
| InChI | InChI=1S/C12H17NO2/c1-3-6-13-7-8-15-12-9-10(14-2)4-5-11(12)13/h3-4,9,11H,1,5-8H2,2H3 |
| InChIKey | OXKWAQPTLYAONO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|