About N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine
N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine (PubChem CID 70458048) has the molecular formula C8H18N2S
and a molecular weight of 174.31 g/mol. Its IUPAC name is N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine |
| PubChem CID | 70458048 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine |
| SMILES | CC(NCCN)C1CCSC1 |
| InChI | InChI=1S/C8H18N2S/c1-7(10-4-3-9)8-2-5-11-6-8/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | XMSWJDSCEQBHTO-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine?
The IUPAC name of N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine (CID 70458048) is N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine?
The canonical SMILES for N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine is CC(NCCN)C1CCSC1.
What is the InChIKey of N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine?
The InChIKey is XMSWJDSCEQBHTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2S/c1-7(10-4-3-9)8-2-5-11-6-8/h7-8,10H,2-6,9H2,1H3.
What are the key properties of N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine?
N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine has a molecular weight of 174.31 g/mol, XLogP of 0.68, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[1-(thiolan-3-yl)ethyl]ethane-1,2-diamine is sourced from PubChem (CID 70458048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).