About N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine
N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine (PubChem CID 70458317) has the molecular formula C7H10ClF2N3S2
and a molecular weight of 273.76 g/mol. Its IUPAC name is N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine |
| PubChem CID | 70458317 |
| Molecular Formula | C7H10ClF2N3S2 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.00 |
| IUPAC Name | N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine |
| SMILES | NCCNC(SC(F)F)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClF2N3S2/c8-6-13-3-4(14-6)5(12-2-1-11)15-7(9)10/h3,5,7,12H,1-2,11H2 |
| InChIKey | DLUYUKDEBLLXBW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine (CID 70458317) is N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine is NCCNC(SC(F)F)c1cnc(Cl)s1.
What is the InChIKey of N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine?
The InChIKey is DLUYUKDEBLLXBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClF2N3S2/c8-6-13-3-4(14-6)5(12-2-1-11)15-7(9)10/h3,5,7,12H,1-2,11H2.
What are the key properties of N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine?
N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine has a molecular weight of 273.76 g/mol, XLogP of 2.30, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(2-chloro-1,3-thiazol-5-yl)-(difluoromethylsulfanyl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 70458317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).