About N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine
N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine (PubChem CID 70458327) has the molecular formula C7H11F2N3OS
and a molecular weight of 223.25 g/mol. Its IUPAC name is N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine |
| PubChem CID | 70458327 |
| Molecular Formula | C7H11F2N3OS |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cnc(OC(F)F)s1 |
| InChI | InChI=1S/C7H11F2N3OS/c8-6(9)13-7-12-4-5(14-7)3-11-2-1-10/h4,6,11H,1-3,10H2 |
| InChIKey | ZQXGVCZSHXSNKS-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine?
The IUPAC name of N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine (CID 70458327) is N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine?
The canonical SMILES for N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine is NCCNCc1cnc(OC(F)F)s1.
What is the InChIKey of N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine?
The InChIKey is ZQXGVCZSHXSNKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11F2N3OS/c8-6(9)13-7-12-4-5(14-7)3-11-2-1-10/h4,6,11H,1-3,10H2.
What are the key properties of N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine?
N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine has a molecular weight of 223.25 g/mol, XLogP of 0.79, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[2-(difluoromethoxy)-1,3-thiazol-5-yl]methyl]ethane-1,2-diamine is sourced from PubChem (CID 70458327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).