About 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol
2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol (PubChem CID 70458369) has the molecular formula C8H14N2O
and a molecular weight of 154.21 g/mol. Its IUPAC name is 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol |
| PubChem CID | 70458369 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol |
| SMILES | NCC(O)C1(N)C=CC=CC1 |
| InChI | InChI=1S/C8H14N2O/c9-6-7(11)8(10)4-2-1-3-5-8/h1-4,7,11H,5-6,9-10H2 |
| InChIKey | MUHOSAGQYZFCDM-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol?
The IUPAC name of 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol (CID 70458369) is 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol.
What is the SMILES notation for 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol?
The canonical SMILES for 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol is NCC(O)C1(N)C=CC=CC1.
What is the InChIKey of 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol?
The InChIKey is MUHOSAGQYZFCDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O/c9-6-7(11)8(10)4-2-1-3-5-8/h1-4,7,11H,5-6,9-10H2.
What are the key properties of 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol?
2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol has a molecular weight of 154.21 g/mol, XLogP of -0.48, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(1-aminocyclohexa-2,4-dien-1-yl)ethanol is sourced from PubChem (CID 70458369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).