About 2-(1-nitrobutylidene)-1,3-thiazinane
2-(1-nitrobutylidene)-1,3-thiazinane (PubChem CID 70458405) has the molecular formula C8H14N2O2S
and a molecular weight of 202.28 g/mol. Its IUPAC name is 2-(1-nitrobutylidene)-1,3-thiazinane.
Molecular Properties
| Compound Name | 2-(1-nitrobutylidene)-1,3-thiazinane |
| PubChem CID | 70458405 |
| Molecular Formula | C8H14N2O2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(1-nitrobutylidene)-1,3-thiazinane |
| SMILES | CCCC(=C1NCCCS1)[N+](=O)[O-] |
| InChI | InChI=1S/C8H14N2O2S/c1-2-4-7(10(11)12)8-9-5-3-6-13-8/h9H,2-6H2,1H3 |
| InChIKey | ULWDDARHPXXFLW-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-nitrobutylidene)-1,3-thiazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-nitrobutylidene)-1,3-thiazinane?
The IUPAC name of 2-(1-nitrobutylidene)-1,3-thiazinane (CID 70458405) is 2-(1-nitrobutylidene)-1,3-thiazinane.
What is the SMILES notation for 2-(1-nitrobutylidene)-1,3-thiazinane?
The canonical SMILES for 2-(1-nitrobutylidene)-1,3-thiazinane is CCCC(=C1NCCCS1)[N+](=O)[O-].
What is the InChIKey of 2-(1-nitrobutylidene)-1,3-thiazinane?
The InChIKey is ULWDDARHPXXFLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2S/c1-2-4-7(10(11)12)8-9-5-3-6-13-8/h9H,2-6H2,1H3.
What are the key properties of 2-(1-nitrobutylidene)-1,3-thiazinane?
2-(1-nitrobutylidene)-1,3-thiazinane has a molecular weight of 202.28 g/mol, XLogP of 1.96, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-nitrobutylidene)-1,3-thiazinane is sourced from PubChem (CID 70458405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).