C23H24N2O4 — CID 70458526
(Z)-but-2-enedioic acid;1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)piperazine (PubChem CID 70458526) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)piperazine.
| Compound Name | (Z)-but-2-enedioic acid;1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)piperazine |
|---|---|
| PubChem CID | 70458526 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-(2-tricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaenyl)piperazine |
| SMILES | C1=Cc2ccccc2C(N2CCNCC2)c2ccccc21.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H20N2.C4H4O4/c1-3-7-17-15(5-1)9-10-16-6-2-4-8-18(16)19(17)21-13-11-20-12-14-21;5-3(6)1-2-4(7)8/h1-10,19-20H,11-14H2;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | CDSDKADWOJTVMW-BTJKTKAUSA-N |
| XLogP | 2.88 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|