C33H55FO6 — CID 70458639
methyl 7-[(1R,2R,3R,5R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-fluoro-3-(oxan-2-yloxy)cyclopentyl]heptanoate (PubChem CID 70458639) has the molecular formula C33H55FO6 and a molecular weight of 566.80 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-fluoro-3-(oxan-2-yloxy)cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2R,3R,5R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-fluoro-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70458639 |
| Molecular Formula | C33H55FO6 |
| Molecular Weight | 566.80 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5R)-2-[(1E,3S)-4,7-dimethyl-3-(oxan-2-yloxy)octa-1,6-dienyl]-5-fluoro-3-(oxan-2-yloxy)cyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](/C=C/[C@@H](OC2CCCCO2)C(C)CC=C(C)C)[C@H](OC2CCCCO2)C[C@H]1F |
| InChI | InChI=1S/C33H55FO6/c1-24(2)17-18-25(3)29(39-32-15-9-11-21-37-32)20-19-27-26(13-7-5-6-8-14-31(35)36-4)28(34)23-30(27)40-33-16-10-12-22-38-33/h17,19-20,25-30,32-33H,5-16,18,21-23H2,1-4H3/b20-19+/t25?,26-,27-,28-,29-,30-,32?,33?/m1/s1 |
| InChIKey | NCCCOGDZVCAUDV-MIYCASTKSA-N |
| XLogP | 7.85 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.80 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|